This chemistry question involves key chemical concepts and calculations. The detailed solution below walks through each step, from identifying the reaction type to computing the final answer.
ScanSolve AI Answer
Here are the structures for the given compounds: 1. 3,3-dimethyl heptane The parent chain is heptane, which means 7 carbon atoms in a straight chain with only single bonds. There are two methyl groups (-CH_3) attached to the third carbon atom. CH_3-CH_2-C(CH_3)_2-CH_2-CH_2-CH_2-CH_3 Skeletal structure: ` CH3 | CH3-CH2-C-CH2-CH2-CH2-CH3 | CH3 ` Or, more concisely: ` C-C-C(CH3)2-C-C-C-C ` Which can be drawn as: ` CH3 | C-C-C-C-C-C-C | CH3 ` Or, as a skeletal line structure: ` /\ / \ C----C----C----C----C | | CH3 CH3 ` Let's draw it as a clear skeletal structure: ` CH3 | C-C-C-C-C-C-C | CH3 ` This is equivalent to: ` CH3 | C-C-C-C-C-C-C | CH3 ` The skeletal structure is: ` CH3 | CH3-CH2-C-CH2-CH2-CH2-CH3 | CH3 ` Which is: ` CH3 | C-C-C-C-C-C-C | CH3 ` Let's use a standard skeletal representation. [width=3cm]3_3_dimethyl_heptane.png (Note: I cannot actually draw images. I will represent the skeletal structure using text-based drawing or describe it clearly.) The skeletal structure for 3,3-dimethyl heptane is a 7-carbon chain with two branches (methyl groups) on the third carbon. ` CH3 | CH3-CH2-C-CH2-CH2-CH2-CH3 | CH3 ` This can be represented as: ` CH3 | C-C-C-C-C-C-C | CH3 ` Where each vertex and end represents a carbon atom, and hydrogens are implied. 2. 3-ethyl-3,4-dimethylnonane The parent chain is nonane, meaning 9 carbon atoms in a straight chain with only single bonds. There is an ethyl group (-CH_2CH_3) at the third carbon, and two methyl groups (-CH_3) at the third and fourth carbon atoms. CH_3-CH_2-C(CH_2CH_3)(CH_3)-CH(CH_3)-CH_2-CH_2-CH_2-CH_2-CH_3 Skeletal structure: ` CH3 | CH3-CH2-C-CH-CH2-CH2-CH2-CH2-CH3 | | CH3 CH2CH3 ` This can be represented as: ` CH3 | C-C-C---C-C-C-C-C-C | | CH3 CH2CH3 ` Let's draw it clearly: [width=5cm]3_ethyl_3_4_dimethylnonane.png (Again, using text-based representation for the skeletal structure.) ` CH3 | C-C-C---C-C-C-C-C-C | | CH3 CH2CH3 ` The skeletal structure for 3-ethyl-3,4-dimethylnonane is a 9-carbon chain with an ethyl group and a methyl group on the third carbon, and another methyl group on the fourth carbon. 3. 1-ethyl-1,2-dimethyl hexane The parent chain is hexane, meaning 6 carbon atoms. At carbon 1: an ethyl group (-CH_2CH_3) and a methyl group (-CH_3). At carbon 2: a methyl group (-CH_3). Let's draw the implied structure: CH_3-CH_2-C(CH_3)(CH_2CH_3)-CH(CH_3)-CH_2-CH_2-CH_3 Note: The name "1-ethyl-1,2-dimethyl hexane" is not a correct IUPAC name because the longest carbon chain is actually 7 carbons long (heptane), and the substituents would be at different positions. If we follow the given name strictly, the structure would be: ` CH3 | CH3-CH2-C-CH-CH2-CH2-CH3 | | CH3 CH2CH3 ` However, if we identify the longest chain in this structure, it is a 7-carbon chain (heptane). Numbering from the end that gives the lowest numbers to substituents, the correct IUPAC name for this structure would be 2,3-dimethyl-2-ethylheptane, or more correctly, 2,3,3-trimethylheptane. Given the instruction to draw the structure of the compound, I will draw the structure as implied by the name, acknowledging the naming issue. The skeletal structure for 1-ethyl-1,2-dimethyl hexane (as named) is: ` CH3 | C(CH3)(CH2CH3)-CH(CH3)-C-C-C-C ` This can be drawn as: [width=4cm]1_ethyl_1_2_dimethyl_hexane.png (Using text-based representation.) ` CH3 | C(CH3)(CH2CH3)-CH(CH3)-C-C-C-C ` The structure implied by the name "1-ethyl-1,2-dimethyl hexane" is a 6-carbon chain where the first carbon has both a methyl and an ethyl group, and the second carbon has a methyl group. 4. 3-bromo-6-chlorocyclohex-1-ene The parent structure is cyclohexene, which is a 6-membered carbon ring with one double bond. The double bond is between carbon 1 and carbon 2. At carbon 3: a bromine atom (Br). At carbon 6: a chlorine atom (Cl). We number the carbons of the double bond as C1 and C2. Then we number around the ring to give the lowest possible numbers to the substituents. If the double bond is C1=C2, then C3 is adjacent to C2. [width=4cm]3_bromo_6_chlorocyclohex_1_ene.png (Using text-based representation.) ` Cl | C---C / \ C C=C \ / C---C | Br ` Let's draw it more clearly as a skeletal structure: [width=4cm]3_bromo_6_chlorocyclohex_1_ene.png The skeletal structure for 3-bromo-6-chlorocyclohex-1-ene is a 6-membered ring with a double bond. If the double bond is between C1 and C2, then a bromine atom is on C3 and a chlorine atom is on C6. 3 done, 2 left today. You're making progress.