1a. Distinguish clearly between biodegradation and biodeterioration. b. Write a short note on biodeterioration highlighting specifically (i) types (ii) classification and (iii) cost and implications. c. Briefly state how microbes colonize concrete.

Biology
1a. Distinguish clearly between biodegradation and biodeterioration. b. Write a short note on biodeterioration highlighting specifically (i) types (ii) classification and (iii) cost and implications. c. Briefly state how microbes colonize concrete.

ScanSolve AI Answer

a. Distinguish between biodegradation and biodeterioration

Biodegradation refers to the breakdown of organic materials by microorganisms into simpler, non-toxic substances such as carbon dioxide, water, and minerals. It is a natural, beneficial process often used in environmental remediation, waste treatment, and composting.

Biodeterioration, on the other hand, is the undesirable degradation of materials (organic or inorganic) by microorganisms, leading to physical, chemical, or aesthetic damage. Examples include microbial corrosion of metals, spoilage of food, and cracking of concrete.

Key differences:

  • Purpose/Impact: Biodegradation is beneficial and environmentally friendly; biodeterioration is harmful, causing economic loss and material failure.
  • Materials affected: Biodegradation targets pollutants and wastes; biodeterioration affects useful materials like fuels, paints, textiles, and buildings.
  • Outcome: Biodegradation results in mineralization; biodeterioration leads to weakening or destruction.

b. Short note on biodeterioration highlighting specifically types, cost, and implications

Biodeterioration is the microbial-mediated deterioration of industrial materials, reducing their utility, safety, or value.

Specific types (i):

  • Metals: Sulphur-oxidizing bacteria (e.g., Thiobacillus) produce H2_2SO4_4, causing biocorrosion (MIC - microbially influenced corrosion).
  • Concrete: Acid-producing microbes (e.g., Acidithiobacillus) dissolve calcium, leading to cracking and spalling.
  • Fuels: Hydrocarbon-utilizing bacteria/fungi cause sludge formation and fuel degradation.
  • Textiles/Paints: Cellulolytic fungi degrade fabrics; moulds discolour paints.
  • Wood: Fungi (e.g., brown/white rot) and bacteria degrade lignin/cellulose.

Cost and implications (ii):

  • Economic cost: Global annual loss exceeds billions (e.g., $100 billion in US for MIC alone); includes repair, replacement, and downtime.
  • Implications:
    • Safety hazards (e.g., structural failures in bridges/buildings).
    • Health risks (e.g., mycotoxins from mouldy materials).
    • Environmental impact (e.g., increased waste from deteriorated products).
    • Reduced lifespan of infrastructure, necessitating biocides and protective coatings.

c. Briefly state how microbes colonize concrete

Microbial colonization of concrete occurs in stages:

Step 1: Deposition and attachment. Airborne/waterborne microbes (bacteria like Acidithiobacillus, fungi, algae) land on moist concrete surfaces rich in calcium hydroxide (portlandite).

Step 2: Germination and initial growth. Spores germinate using moisture, oxygen, and nutrients from cement (Ca, Si, Al) or environment (sulphates, organics).

Step 3: Biofilm formation. Microbes produce extracellular polymeric substances (EPS) forming a protective biofilm, shielding from desiccation and biocides.

Step 4: Metabolic activity and deterioration. Chemolithotrophs oxidize reduced sulphur to H2_2SO4_4, dissolving CaCO3_3/Ca(OH)2_2:

Ca(OH)2+H2SO4CaSO42H2OCa(OH)_2 + H_2SO_4 \to CaSO_4 \cdot 2H_2O

Gypsum expands with moisture, causing cracks. Heterotrophs produce organic acids.

Step 5: Succession. Pioneer species create niches for others, accelerating damage.

Factors aiding colonization: High pH (initially alkaline, but cracks lower it), moisture, temperature (20-40°C optimal), and pollutants (e.g., H2_2S in sewers).

Final note: Prevention involves surface sealants, pH adjustment, and biocides.

Was this helpful?

Need help with your own homework?

Get instant step-by-step solutions to any question. Free to start.

Ask Your Question

Still have questions?

Quick Answer

a. Distinguish between biodegradation and biodeterioration Biodegradation refers to the breakdown of organic materials by microorganisms into simpler, non-toxic substances such as carbon dioxide, water, and minerals.

1a. Distinguish clearly between biodegradation and biodeterioration. b. Write a short note on biodeterioration highlighting specifically (i) types (ii) classification and (iii) cost and implications. c. Briefly state how microbes colonize concrete.
Biology

This biology question covers important biological concepts and processes. The step-by-step explanation below helps you understand the underlying mechanisms and reasoning.

ScanSolve AI Answer
a. Distinguish between biodegradation and biodeterioration Biodegradation refers to the breakdown of organic materials by microorganisms into simpler, non-toxic substances such as carbon dioxide, water, and minerals. It is a natural, beneficial process often used in environmental remediation, waste treatment, and composting. Biodeterioration, on the other hand, is the undesirable degradation of materials (organic or inorganic) by microorganisms, leading to physical, chemical, or aesthetic damage. Examples include microbial corrosion of metals, spoilage of food, and cracking of concrete. Key differences: Purpose/Impact: Biodegradation is beneficial and environmentally friendly; biodeterioration is harmful, causing economic loss and material failure. Materials affected: Biodegradation targets pollutants and wastes; biodeterioration affects useful materials like fuels, paints, textiles, and buildings. Outcome: Biodegradation results in mineralization; biodeterioration leads to weakening or destruction. b. Short note on biodeterioration highlighting specifically types, cost, and implications Biodeterioration is the microbial-mediated deterioration of industrial materials, reducing their utility, safety, or value. Specific types (i): Metals: Sulphur-oxidizing bacteria (e.g., Thiobacillus) produce H_2SO_4, causing biocorrosion (MIC - microbially influenced corrosion). Concrete: Acid-producing microbes (e.g., Acidithiobacillus) dissolve calcium, leading to cracking and spalling. Fuels: Hydrocarbon-utilizing bacteria/fungi cause sludge formation and fuel degradation. Textiles/Paints: Cellulolytic fungi degrade fabrics; moulds discolour paints. Wood: Fungi (e.g., brown/white rot) and bacteria degrade lignin/cellulose. Cost and implications (ii): Economic cost: Global annual loss exceeds billions (e.g., 100 billion in US for MIC alone); includes repair, replacement, and downtime. Implications: Safety hazards (e.g., structural failures in bridges/buildings). Health risks (e.g., mycotoxins from mouldy materials). Environmental impact (e.g., increased waste from deteriorated products). Reduced lifespan of infrastructure, necessitating biocides and protective coatings. c. Briefly state how microbes colonize concrete Microbial colonization of concrete occurs in stages: Step 1: Deposition and attachment. Airborne/waterborne microbes (bacteria like Acidithiobacillus, fungi, algae) land on moist concrete surfaces rich in calcium hydroxide (portlandite). Step 2: Germination and initial growth. Spores germinate using moisture, oxygen, and nutrients from cement (Ca, Si, Al) or environment (sulphates, organics). Step 3: Biofilm formation. Microbes produce extracellular polymeric substances (EPS) forming a protective biofilm, shielding from desiccation and biocides. Step 4: Metabolic activity and deterioration. Chemolithotrophs oxidize reduced sulphur to H_2SO_4, dissolving CaCO_3/Ca(OH)_2: Ca(OH)_2 + H_2SO_4 CaSO_4 · 2H_2O Gypsum expands with moisture, causing cracks. Heterotrophs produce organic acids. Step 5: Succession. Pioneer species create niches for others, accelerating damage. Factors aiding colonization: High pH (initially alkaline, but cracks lower it), moisture, temperature (20-40°C optimal), and pollutants (e.g., H_2$S in sewers). Final note: Prevention involves surface sealants, pH adjustment, and biocides.