Name the following organic compound using IUPAC nomenclature: CH3-CH2-CH(Br)(CH2CH3)-CH2-CH3

Question

ScanSolve AI Tutor · Accepted Answer

To name the given organic compound, we follow the IUPAC nomenclature rules:

Identify the longest continuous carbon chain.
The longest continuous carbon chain in the molecule is five carbons long:
CH₃ - CH₂ - CH - CH₂ - CH₃
This chain is a pentane.
Number the carbon chain to give substituents the lowest possible numbers.
If we number from left to right:
$\text{CH}_3 - \text{CH}_2 - \overset{3}{\text{CH}} - \text{CH}_2 - \text{CH}_3$
The substituents are on carbon 3.
If we number from right to left:
$\text{CH}_3 - \text{CH}_2 - \overset{3}{\text{CH}} - \text{CH}_2 - \text{CH}_3$
The substituents are still on carbon 3.
So, the numbering is unambiguous, and the substituents are located at position 3.
Identify and name the substituents.
Attached to carbon 3 are:
- A bromine atom ( $\text{Br}$ ), which is named bromo.
- An ethyl group ( $\text{CH}_2\text{CH}_3$ ), which is named ethyl.
Assemble the name in alphabetical order.
Alphabetically, "bromo" comes before "ethyl". Both are at position 3.

The full IUPAC name is:
$\text{3-bromo-3-ethylpentane}$

Answer