Name the following organic compound: CH3-C(CH3)2-CH2-CH(Br)-CH3

Question

ScanSolve AI Tutor · Accepted Answer

Step 1: Identify the longest continuous carbon chain. The longest continuous carbon chain in the molecule is 5 carbons long. This means the parent alkane is pentane. Step 2: Number the carbon chain to give the lowest possible numbers to the substituents. Let's consider two ways of numbering: Numbering from left to right: CH₃−C(CH₃)₂−CH₂−CH(Br)−CH₃ 1 2 3 4 5 Substituents: Two methyl groups at carbon 2 (2,2-dimethyl) and one bromo group at carbon 4 (4-bromo). The set of locants for the substituents is (2, 2, 4). Numbering from right to left: CH₃−CH(Br)−CH₂−C(CH₃)₂−CH₃ 5 4 3 2 1 Substituents: One bromo group at carbon 2 (2-bromo) and two methyl groups at carbon 4 (4,4-dimethyl). The set of locants for the substituents is (2, 4, 4). Comparing the two sets of locants (2, 2, 4) and (2, 4, 4), the first point of difference is the second number (2 vs 4). Since 2 is lower than 4, the numbering from left to right is preferred. Step 3: Identify and name the substituents with their correct locants. At carbon 2: two methyl groups, so "2,2-dimethyl". At carbon 4: one bromo group, so "4-bromo". Step 4: Arrange the substituents alphabetically. Alphabetical order ignores prefixes like "di-". So, "bromo" comes before "methyl". Step 5: Combine the substituent names and the parent alkane name. The full IUPAC name is 4-bromo-2,2-dimethylpentane. The IUPAC name of the compound is: 4-bromo-2,2-dimethylpentane

Name the following organic compound: CH3-C(CH3)2-CH2-CH(Br)-CH3

Answer

Step-by-step solution

Identify the longest continuous carbon chain.

Number the carbon chain to give the lowest possible numbers to the substituents.

Identify and name the substituents with their correct locants.

Arrange the substituents alphabetically.

Combine the substituent names and the parent alkane name.

Try one yourself

Still stuck on this one?

More Chemistry Questions