Name the following organic compound: CH3-CH(Br)-CH(CH3)-CH2-CH3. Write the structure of HO-CH2-C≡C-CH2-C≡CH.

The longest continuous carbon chain is 5 carbons long (pentane).

If numbered from left to right:
Carbon 2 has a bromine ($\text{Br}$).
Carbon 3 has a methyl ($\text{CH}_{3}$).
The locants are 2, 3.

If numbered from right to left:
Carbon 3 has a methyl ($\text{CH}_{3}$).
Carbon 4 has a bromine ($\text{Br}$).
The locants are 3, 4.
The lowest set of locants is 2, 3. So, we number from left to right.

At carbon 2: Bromo ($\text{Br}$)
At carbon 3: Methyl ($\text{CH}_{3}$)
Alphabetical order: Bromo before Methyl.

The full name is 2-bromo-3-methylpentane.

The name of the compound is:

2) Write the structure of $\text{HO}-\text{CH}_{2}-\text{C}\equiv\text{C}-\text{CH}_{2}-\text{C}\equiv\text{CH}$.

The compound has an alcohol ($\text{OH}$) group, two alkyne ($\text{C}\equiv\text{C}$) groups, and a 6-carbon chain.

In a