We read your photo as:
What is the IUPAC name of the following hydrocarbon? CH3−C(CH3)=CH−CH(CH2CH3)−CH3
Chemistry
ScanSolve AI Answer
To determine the IUPAC name for the given hydrocarbon, we follow these steps:
- Identify the longest continuous carbon chain that includes the double bond.
The given structure is:
Let's trace the longest chain containing the double bond (C=C).
CH₃ | CH₃ - C = CH - CH - CH₃ | CH₂CH₃- If we consider the chain from the leftmost CH₃ to the rightmost CH₃, it's 5 carbons long (pentene). The ethyl group (CH₂CH₃) would be a substituent.
- However, the ethyl group can be part of the main chain. If we extend the chain through
Was this helpful?
Still stuck on this one?
Ask a follow-up, and the answer starts from this question.
Got a different question?Ask your own question
More Chemistry Questions
QWhat is the IUPAC name of the following compound: CH3-CH(CH3)-CH(CH3)-CH2-CH3?QWhat is the IUPAC name for the compound CH3CH(C2H5)CH2CH(CH3)CH3?QWhat is the IUPAC name for the following structure: CH3CH(CH3)CH2CH2OH?QWhat is the IUPAC name for the compound CH3CH(CH3)CH2CHO?QProvide the IUPAC names for the following organic compounds: a) CH3-CH2-C(=O)-CH(CH3)-CH3
Browse by topic:Organic Chemistry