a) Write the structural formula of 2-bromo-4-methylpentane. b) Write the equation of reaction of nucleophilic substitution btn 2-bromo-4-methylpentane and aqueous Sodium Hydroxide. c) 2-bromo-4-methylpentane is made to react with Sodium Cyanide to form product A. The resultant organic product A is reacted with H2O in presence of H2O to give product B. Give the IUPAC name for the structural formula of compounds A and B. d) What's meant by the term isoelectric point?

Chemistry
a) Write the structural formula of 2-bromo-4-methylpentane. b) Write the equation of reaction of nucleophilic substitution btn 2-bromo-4-methylpentane and aqueous Sodium Hydroxide. c) 2-bromo-4-methylpentane is made to react with Sodium Cyanide to form product A. The resultant organic product A is reacted with H2O in presence of H2O to give product B. Give the IUPAC name for the structural formula of compounds A and B. d) What's meant by the term isoelectric point?

ScanSolve AI Answer

a) The structural formula of 2-bromo-4-methylpentane is: CH3CH(Br)CH2CH(CH3)CH3CH_3CH(Br)CH_2CH(CH_3)CH_3

b) The equation for the nucleophilic substitution reaction between 2-bromo-4-methylpentane and aqueous sodium hydroxide is: CH3CH(Br)CH2CH(CH3)CH3(aq)+NaOH(aq)⟶CH3CH(OH)CH2CH(CH3)CH3(aq)+NaBr(aq)CH_3CH(Br)CH_2CH(CH_3)CH_3 (aq) + NaOH (aq) \longrightarrow CH_3CH(OH)CH_2CH(CH_3)CH_3 (aq) + NaBr (aq)

c) Step 1: Reaction of 2-bromo-4-methylpentane with sodium cyanide. The bromine atom is replaced by a cyanide group. The structural formula of product A is: CH3CH(CN)CH2CH(CH3)CH3CH_3CH(CN)CH_2CH(CH_3)CH_3 The IUPAC name for compound A is 3-methylbutanenitrile.

Step 2: Hydrolysis of product A (nitrile) with H₂O in the presence of H⁺. The nitrile group is hydrolyzed to a carboxylic acid group. The structural formula of product B is: CH3CH(COOH)CH2CH(CH3)CH3CH_3CH(COOH)CH_2CH(CH_3)CH_3 The IUPAC name for compound B is 3-methylbutanoic acid.

Was this helpful?

Need help with your own homework?

Get instant step-by-step solutions to any question. Free to start.

Ask Your Question
Got a syllabus? Photograph it and I'll tell you what's due and what's worth the most.
Handwritten step-by-step solution preview

Handwritten Step-by-Step Solution

Get this as a handwritten image on WhatsApp — like a tutor wrote it for you.

Try on WhatsApp

More Chemistry Questions

Q200 g of calcium carbonate completely reacted with dilute HCL in 2 minute.What is the rate of reacti…QWhat's an isotopeQWhat is an isotopeQASSIGNMENT Write all the possible isomers of Butanol and make sure you define each of the isomerism…QWhat us the formula for butanol
See all Chemistry questions →

Still have questions?

Quick Answer

a) The structural formula of 2-bromo-4-methylpentane is: CH_3CH(Br)CH_2CH(CH_3)CH_3 b) The equation for the nucleophilic substitution reaction between 2-bromo-4-methylpentane and aqueous sodium hydroxide is: CH_3CH(Br)CH_2CH(CH_3)CH_3 (aq) + NaOH (aq)…

a) Write the structural formula of 2-bromo-4-methylpentane. b) Write the equation of reaction of nucleophilic substitution btn 2-bromo-4-methylpentane and aqueous Sodium Hydroxide. c) 2-bromo-4-methylpentane is made to react with Sodium Cyanide to form product A. The resultant organic product A is reacted with H2O in presence of H2O to give product B. Give the IUPAC name for the structural formula of compounds A and B. d) What's meant by the term isoelectric point?
Chemistry

This chemistry question involves key chemical concepts and calculations. The detailed solution below walks through each step, from identifying the reaction type to computing the final answer.

ScanSolve AI Answer
a) The structural formula of 2-bromo-4-methylpentane is: CH_3CH(Br)CH_2CH(CH_3)CH_3 b) The equation for the nucleophilic substitution reaction between 2-bromo-4-methylpentane and aqueous sodium hydroxide is: CH_3CH(Br)CH_2CH(CH_3)CH_3 (aq) + NaOH (aq) CH_3CH(OH)CH_2CH(CH_3)CH_3 (aq) + NaBr (aq) c) Step 1: Reaction of 2-bromo-4-methylpentane with sodium cyanide. The bromine atom is replaced by a cyanide group. The structural formula of product A is: CH_3CH(CN)CH_2CH(CH_3)CH_3 The IUPAC name for compound A is 3-methylbutanenitrile. Step 2: Hydrolysis of product A (nitrile) with H₂O in the presence of H⁺. The nitrile group is hydrolyzed to a carboxylic acid group. The structural formula of product B is: CH_3CH(COOH)CH_2CH(CH_3)CH_3 The IUPAC name for compound B is 3-methylbutanoic acid.