5moldm³ 30cm³ CH₃COOH solution is neutralized by Ba(OH)₂ solution. 0.75dm³ of the solution is used. If 10cm³ of Ba(OH)₂ solution is neutralized by 0.1moldm⁻³ NaOH solution, calculate W.

Chemistry
5moldm³ 30cm³ CH₃COOH solution is neutralized by Ba(OH)₂ solution. 0.75dm³ of the solution is used. If 10cm³ of Ba(OH)₂ solution is neutralized by 0.1moldm⁻³ NaOH solution, calculate W.

ScanSolve AI Answer

Answer

2.52

Initial amount of CH3COOH\mathrm{CH_3COOH}:
n=0.50moldm3×0.025dm3=0.0125moln = 0.50 \, mol \, dm^{-3} \times 0.025 \, dm^3 = 0.0125 \, mol

Equivalence volume of NaOH\mathrm{NaOH}:
Veq=0.0125mol0.10moldm3=0.125dm3=125cm3V_{eq} = \frac{0.0125 \, mol}{0.10 \, mol \, dm^{-3}} = 0.125 \, dm^3 = 125 \, cm^3

Ka=1.8×105moldm3K_a = 1.8 \times 10^{-5} \, mol \, dm^{-3}
pKa=log(1.8×105)=4.74\mathrm{p}K_a = -\log(1.8 \times 10^{-5}) = 4.74

(i) Before adding NaOH\mathrm{NaOH}
Weak acid:
[H+]=KaC[H^+] = \sqrt{K_a C}
Substitute:
[H+]=1.8×105×0.50=9.0×106=3.0×103moldm3[H^+] = \sqrt{1.8 \times 10^{-5} \times 0.50} = \sqrt{9.0 \times 10^{-6}} = 3.0 \times 10^{-3} \, mol \, dm^{-3}
pH=log(3.0×103)=2.52pH = -\log(3.0 \times 10^{-3}) = 2.52
2.52

(ii) After adding 10cm310 \, \mathrm{cm^3} NaOH\mathrm{NaOH}
Moles NaOH\mathrm{NaOH} added:
n=0.10moldm3×0.010dm3=0.0010moln = 0.10 \, mol \, dm^{-3} \times 0.010 \, dm^3 = 0.0010 \, mol
Moles CH3COOH\mathrm{CH_3COOH} left:
0.01250.0010=0.0115mol0.0125 - 0.0010 = 0.0115 \, mol
Moles CH3COO\mathrm{CH_3COO^-}:
0.0010mol0.0010 \, mol
Total volume:
25+10=35cm3=0.035dm325 + 10 = 35 \, cm^3 = 0.035 \, dm^3
Buffer:
pH=pKa+log(nCH3COOnCH3COOH)pH = pK_a + \log \left( \frac{n_{CH_3COO^-}}{n_{CH_3COOH}} \right)
Ratio:
0.00100.0115=0.087\frac{0.0010}{0.0115} = 0.087
log(0.087)=1.06\log(0.087) = -1.06
pH=4.74+(1.06)=3.68pH = 4.74 + (-1.06) = 3.68
3.68

(iii) At equivalence point (125cm3125 \, \mathrm{cm^3} NaOH\mathrm{NaOH})
Moles CH3COO=0.0125mol\mathrm{CH_3COO^-} = 0.0125 \, \mathrm{mol}
Total volume:
25+125=150cm3=0.150dm325 + 125 = 150 \, cm^3 = 0.150 \, dm^3
Cb=0.01250.150=0.0833moldm3C_b = \frac{0.0125}{0.150} = 0.0833 \, mol \, dm^{-3}
Kb=1.0×10141.8×105=5.56×1010moldm3K_b = \frac{1.0 \times 10^{-14}}{1.8 \times 10^{-5}} = 5.56 \times 10^{-10} \, mol \, dm^{-3}
Weak base:
[OH]=KbCb[OH^-] = \sqrt{K_b C_b}
Substitute:
[OH]=5.56×1010×0.0833=4.63×1011=6.8×106moldm3[OH^-] = \sqrt{5.56 \times 10^{-10} \times 0.0833} = \sqrt{4.63 \times 10^{-11}} = 6.8 \times 10^{-6} \, mol \, dm^{-3}
pOH=log(6.8×106)=5.17pOH = -\log(6.8 \times 10^{-6}) = 5.17
pH=14.005.17=8.83pH = 14.00 - 5.17 = 8.83
8.83

(iv) After adding 30cm330 \, \mathrm{cm^3} NaOH\mathrm{NaOH}
Moles NaOH\mathrm{NaOH} added:
0.10×0.030=0.0030mol0.10 \times 0.030 = 0.0030 \, mol
Moles CH3COOH\mathrm{CH_3COOH} left:
0.01250.0030=0.0095mol0.0125 - 0.0030 = 0.0095 \, mol
Moles CH3COO\mathrm{CH_3COO^-}:
0.0030mol0.0030 \, mol
Total volume:
25+30=55cm3=0.055dm325 + 30 = 55 \, cm^3 = 0.055 \, dm^3
Buffer:
nCH3COOnCH3COOH=0.00300.0095=0.316\frac{n_{CH_3COO^-}}{n_{CH_3COOH}} = \frac{0.0030}{0.0095} = 0.316
log(0.316)=0.50\log(0.316) = -0.50
pH=4.74+(0.50)=4.24pH = 4.74 + (-0.50) = 4.24
4.24

Was this helpful?

Need help with your own homework?

Get instant step-by-step solutions to any question. Free to start.

Ask Your Question

Still have questions?

Quick Answer

Initial amount of CH_3COOH: n = 0.50 \, mol \, dm^-3 × 0.025 \, dm^3 = 0.0125 \, mol Equivalence volume of NaOH: V_eq = 0.0125 \, mol0.10 \, mol \, dm^-3 = 0.125 \, dm^3 = 125 \, cm^3 K_a = 1.8 × 10^-5 \, mol \, dm^-3 pK_a = -(1.8 × 10^-5) = 4.74 (i)…

5moldm³ 30cm³ CH₃COOH solution is neutralized by Ba(OH)₂ solution. 0.75dm³ of the solution is used. If 10cm³ of Ba(OH)₂ solution is neutralized by 0.1moldm⁻³ NaOH solution, calculate W.
Chemistry

This chemistry question involves key chemical concepts and calculations. The detailed solution below walks through each step, from identifying the reaction type to computing the final answer.

ScanSolve AI Answer
Initial amount of CH_3COOH: n = 0.50 \, mol \, dm^-3 × 0.025 \, dm^3 = 0.0125 \, mol Equivalence volume of NaOH: V_eq = 0.0125 \, mol0.10 \, mol \, dm^-3 = 0.125 \, dm^3 = 125 \, cm^3 K_a = 1.8 × 10^-5 \, mol \, dm^-3 pK_a = -(1.8 × 10^-5) = 4.74 (i) Before adding NaOH Weak acid: [H^+] = sqrt(K_a C) Substitute: [H^+] = sqrt(1.8 × 10^-5) × 0.50 = sqrt(9.0 × 10^-6) = 3.0 × 10^-3 \, mol \, dm^-3 pH = -(3.0 × 10^-3) = 2.52 2.52 (ii) After adding 10 \, cm^3 NaOH Moles NaOH added: n = 0.10 \, mol \, dm^-3 × 0.010 \, dm^3 = 0.0010 \, mol Moles CH_3COOH left: 0.0125 - 0.0010 = 0.0115 \, mol Moles CH_3COO^-: 0.0010 \, mol Total volume: 25 + 10 = 35 \, cm^3 = 0.035 \, dm^3 Buffer: pH = pK_a + ( n_CH_3COO^-n_CH_3COOH ) Ratio: (0.0010)/(0.0115) = 0.087 (0.087) = -1.06 pH = 4.74 + (-1.06) = 3.68 3.68 (iii) At equivalence point (125 \, cm^3 NaOH) Moles CH_3COO^- = 0.0125 \, mol Total volume: 25 + 125 = 150 \, cm^3 = 0.150 \, dm^3 C_b = (0.0125)/(0.150) = 0.0833 \, mol \, dm^-3 K_b = 1.0 × 10^-141.8 × 10^-5 = 5.56 × 10^-10 \, mol \, dm^-3 Weak base: [OH^-] = sqrt(K_b C_b) Substitute: [OH^-] = sqrt(5.56 × 10^-10) × 0.0833 = sqrt(4.63 × 10^-11) = 6.8 × 10^-6 \, mol \, dm^-3 pOH = -(6.8 × 10^-6) = 5.17 pH = 14.00 - 5.17 = 8.83 8.83 (iv) After adding 30 \, cm^3 NaOH Moles NaOH added: 0.10 × 0.030 = 0.0030 \, mol Moles CH_3COOH left: 0.0125 - 0.0030 = 0.0095 \, mol Moles CH_3COO^-: 0.0030 \, mol Total volume: 25 + 30 = 55 \, cm^3 = 0.055 \, dm^3 Buffer: n_CH_3COO^-n_CH_3COOH = (0.0030)/(0.0095) = 0.316 (0.316) = -0.50 pH = 4.74 + (-0.50) = 4.24 4.24