Determine the IUPAC name for the following molecule: CH3-CH(CH3)-CH(CH2CH2CH2CH3)-COOH

Question

ScanSolve AI Tutor · Accepted Answer

Here's how to determine the IUPAC name for the given structure:

Identify the highest priority functional group.
The molecule contains a carboxylic acid group ( $\text{-COOH}$ ). This group has the highest priority and will define the suffix of the parent chain as "-oic acid". The carbon atom of the carboxylic acid group is always designated as C1.
Identify the longest continuous carbon chain that includes the carboxylic acid carbon (C1).
Let's write out the structure linearly to make it easier to trace the chain:
$\text{CH}_3-\text{CH}(\text{CH}_3)-\text{CH}(\text{CH}_2\text{CH}_2\text{CH}_2\text{CH}_3)-\text{COOH}$

Starting from the carboxylic acid carbon (C1):
- C1 is the carbon of the $\text{-COOH}$ group.
- C2 is the $\text{CH}$ carbon directly attached to C1.
- From C2, we can go to the $\text{CH}_2\text{CH}_2\text{CH}_2\text{CH}_3$ chain. This chain has 4 carbons. So, the longest continuous chain including C1 would be: $\text{C1}(\text{COOH}) - \text{C2}(\text{CH}) - \text{C3}(\text{CH}_2) - \text{C4}(\text{CH}_2) - \text{C5}(\text{CH}_2) - \text{C6}(\text{CH}_3)$ This chain is 6 carbons long. Therefore, the parent name is hexanoic acid.
Identify and number the substituents on the parent chain.
The parent chain is hexanoic acid,

Step-by-step solution