Provide the IUPAC names for the following carboxylic acids: (I) COOH-C(CH3)2-CH2-CH2-CH(CH3)-CH3 (II)…

Question

Provide the IUPAC names for the following carboxylic acids: (I) COOH-C(CH3)2-CH2-CH2-CH(CH3)-CH3 (II) COOH-CH(C6H5)-CH3

ScanSolve AI Tutor · Accepted Answer

Here are the names for the given compounds:

I)

Identify the functional group.
The compound contains a carboxyl group $(-\text{COOH})$ , so it is a carboxylic acid.
Identify the longest carbon chain that includes the carboxyl carbon.
Numbering starts from the carboxyl carbon (C1).
The main chain is: $\text{COOH}-\text{C}(\text{CH}_3)_2-\text{CH}_2-\text{CH}_2-\text{CH}(\text{CH}_3)-\text{CH}_3$ .
This chain has 6 carbons, making the parent acid hexanoic acid.
Identify and number the substituents.
There are two methyl groups on C2 and one methyl group on C5.
Combine the information to form the IUPAC name.
The name is 2,2,5-trimethylhexanoic acid.

The name of compound (I) is: $\boxed{\text{2,2,5-trimethylhexanoic acid}}$

II)
Identify the functional group.
The compound contains a carboxyl group $(-\text{COOH})$ , so it is a carboxylic acid.
Identify the longest carbon chain that includes the carboxyl carbon.
Numbering starts from the carboxyl carbon (C1).
The main chain is: $\text{COOH}-\text{CH}(\text{C}_6\text{H}_5)-\text{CH}_3$ .
This chain has 3 carbons, making the parent acid propanoic acid.
Identify and number the substituents.
There is a phenyl group $(-\text{C}_6\text{H}_5)$ on C2.
Combine the information to form the IUPAC name.
The name is 2-phenylpropanoic acid.

The name of compound (II) is: $\boxed{\text{2-phenylpropanoic acid}}$

Provide the IUPAC names for the following carboxylic acids: (I) COOH-C(CH3)2-CH2-CH2-CH(CH3)-CH3 (II) COOH-CH(C6H5)-CH3