The following set-up was used to investigate the percentage of oxygen in air by volume. (a) State and explain the observations made when a gas jar is inverted over the burning candle.

Chemistry
The following set-up was used to investigate the percentage of oxygen in air by volume. (a) State and explain the observations made when a gas jar is inverted over the burning candle.

ScanSolve AI Answer

Step 1: Identify the reactants.
Ethanol: C2H5OH(aq)\mathrm{C_2H_5OH(aq)} (an alcohol).
Formic acid: HCOOH\mathrm{HCOOH} (a carboxylic acid).

Step 2: Determine the reaction type.
This is an esterification reaction (condensation reaction between an alcohol and a carboxylic acid).
General equation:
ROH+HOOCRRCOOR+H2OROH + HOOC-R' \to R'COOR + H_2O

Step 3: Substitute the groups.
For ethanol, R=C2H5\mathrm{R = C_2H_5-}.
For formic acid, R=H\mathrm{R' = H-}.
Ester product: HCOOC2H5\mathrm{HCOOC_2H_5} (ethyl formate).
Byproduct: H2O\mathrm{H_2O}.

Step 4: Write the complete balanced equation.
C2H5OH(aq)+HCOOHHCOOC2H5+H2OC_2H_5OH(aq) + HCOOH \to HCOOC_2H_5 + H_2O

\mathrm{C_2H_5OH(aq) + HCOOH \to HCOOC_2H_5 + H_2O}

Was this helpful?

Still stuck on this one?

Ask a follow-up, and the answer starts from this question.

Got a different question?Ask your own question