Complete the following reactions: a) CH3CH2C=CCH2CH3 + HCN b) CH3CH2CH2CH2C=CH + HCN

Chemistry
Complete the following reactions: a) CH3CH2C=CCH2CH3 + HCN b) CH3CH2CH2CH2C=CH + HCN

ScanSolve AI Answer

a) The completed chemical reaction is: CH_3CH_2COCH_2CH_3 + HCN \xrightarrow{KCN} \text{CH_3CH_2C(OH)(CN)CH_2CH_3} The IUPAC name for the product is 3-hydroxy-3-cyanopentane.

The chemical mechanism is: Step 1: Nucleophilic attack by cyanide ion. The cyanide ion (CN\text{CN}^-), generated from KCN, acts as a nucleophile and attacks the electrophilic carbon atom of the carbonyl group in 3-pentanone. The π\pi electrons of the carbon-oxygen double bond shift to the oxygen atom, forming an alkoxide intermediate. CH3CH2C(=O)CH2CH3+CNCH3CH2C(O)(CN)CH2CH3CH_3CH_2C(=O)CH_2CH_3 + CN^- \longrightarrow CH_3CH_2C(O^-)(CN)CH_2CH_3

Step 2: Protonation of the alkoxide. The alkoxide intermediate is then protonated by hydrogen cyanide (HCN) to form the stable cyanohydrin product. The cyanide ion is regenerated in this step. CH3CH2C(O)(CN)CH2CH3+HCNCH3CH2C(OH)(CN)CH2CH3+CNCH_3CH_2C(O^-)(CN)CH_2CH_3 + HCN \longrightarrow CH_3CH_2C(OH)(CN)CH_2CH_3 + CN^-

b) The completed chemical reaction is: CH_3CH_2CH_2CH_2CHO + HCN \xrightarrow{NaCN} \text{CH_3CH_2CH_2CH_2CH(OH)CN} The IUPAC name for the product is 2-hydroxypentanenitrile.

The chemical mechanism is: Step 1: Nucleophilic attack by cyanide ion. The cyanide ion (CN\text{CN}^-), generated from NaCN, acts as a nucleophile and attacks the electrophilic carbon atom of the carbonyl group in pentanal. The π\pi electrons of the carbon-oxygen double bond shift to the oxygen atom, forming an alkoxide intermediate. CH3CH2CH2CH2CHO+CNCH3CH2CH2CH2CH(O)CNCH_3CH_2CH_2CH_2CHO + CN^- \longrightarrow CH_3CH_2CH_2CH_2CH(O^-)CN

Step 2: Protonation of the alkoxide. The alkoxide intermediate is then protonated by hydrogen cyanide (HCN) to form the stable cyanohydrin product. The cyanide ion is regenerated in this step. CH3CH2CH2CH2CH(O)CN+HCNCH3CH2CH2CH2CH(OH)CN+CNCH_3CH_2CH_2CH_2CH(O^-)CN + HCN \longrightarrow CH_3CH_2CH_2CH_2CH(OH)CN + CN^-

Was this helpful?

Still stuck on this one?

Ask a follow-up, and the answer starts from this question.

Got a different question?Ask your own question
Handwritten step-by-step solution preview

Handwritten Step-by-Step Solution

Get this as a handwritten image on WhatsApp — like a tutor wrote it for you.

Try on WhatsApp